| Catalog Number |
ACM2374143-1 |
| CAS Number |
2374-14-3 |
| Structure |
 |
| Synonyms |
(3,3,3-Trifluoropropyl)methylcyclotrisiloxane |
| Molecular Weight |
468.54 g/mol |
| Molecular Formula |
C12H21F9O3Si3 |
| Canonical SMILES |
C[Si]1(O[Si](O[Si](O1)(C)CCC(F)(F)F)(C)CCC(F)(F)F)CCC(F)(F)F |
| Boiling Point |
135°Cat 22 mmHg |
| Melting Point |
23°C |
| Flash Point |
107.1 °C |
| Purity |
>99% |
| Density |
1.24 g/mL at 25°C |
| Solubility |
Insoluble in water. |
| Appearance |
Low melting point colorless clear crystals or liquid |
| Application |
1,3,5-Tris[(3,3,3-trifluoropropyl)methyl]cyclotrisiloxane is a silicon compound |
| Storage |
Store at room temperature. |
| Chemical Formula |
C12H21F9O3Si3 |
| EC Number |
219-154-7 |
| Hazardous Materials Information |
This is classified as a Dangerous Good for transport and may be subject to additional shipping charges. |
| MDL Number |
MFCD00054667 |
| Physical State |
Low-Melting Solid |
| Reaxys Registry Number |
1809096 |
| Refractive Index |
n20D 1.37 |
| RTECS |
GZ4818000 |
