| Catalog Number | ACM38170808 |
|---|---|
| CAS Number | 38170-80-8 |
| Structure | ![]() |
| Synonyms | (Benzene-1,3-Diyldiethyne-2,1-Diyl)Bis(Trimethylsilane) |
| IUPAC Name | trimethyl-[2-[3-(2-trimethylsilylethynyl)phenyl]ethynyl]silane |
| Molecular Weight | 270.52 g/mol |
| Molecular Formula | C16H22Si2 |
| Canonical SMILES | C[Si](C)(C)C#CC1=CC(=CC=C1)C#C[Si](C)(C)C |
| InChI Key | ASZOZZMGMNVKDV-UHFFFAOYSA-N |
| Boiling Point | 304.9 °C(760 mmHg) |
| Melting Point | 57 °C |
| Flash Point | 120.9 °C |
| Purity | 0.96 |
| Density | 0.92 g/mL |
| Solubility | Soluble in Toluene. |
| Appearance | White to Almost white powder to crystal |
| Storage | Ambient temperatures. |
| Exact Mass | 270.12600 |
| MDL Number | MFCD00078305 |
| Packaging | 10 g; 100 g; |
| Reaxys Registry Number | 2845239 |
| Refractive Index | 1.505 |
※ Please kindly noted that this product is for research use only.