| Catalog Number | ACM2615181-4 |
|---|---|
| CAS Number | 2615-18-1 |
| Structure | ![]() |
| Synonyms | 1,4-Bis(triethoxysilyl)benzene, 2615-18-1, SureCN50701, AGN-PC-00A8YG, 598038_ALDRICH, CTK4F7171, Benzene,1,4-bis(triethoxysilyl)-, Benzene, 1,4-bis(triethoxysilyl)-, Silane, 1,4-phenylenebis[triethoxy-, AKOS015889133, AG-E-81497, AM808117, I01-17011, Silane,1,4-phenylenebis[triethoxy- (9CI); Silane, p-phenylenebis[triethoxy- (7CI,8CI);1,4-Bis(triethoxysilyl)benzene; p-Phenylenebis(triethoxysilane) |
| IUPAC Name | triethoxy-(4-triethoxysilylphenyl)silane |
| Molecular Weight | 402.64 g/mol |
| Molecular Formula | C18H34O6Si2 |
| Canonical SMILES | CCO[Si](C1=CC=C(C=C1)[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI Key | YYJNCOSWWOMZHX-UHFFFAOYSA-N |
| Boiling Point | 130-132/0.4 |
| Melting Point | >0ºC |
| Flash Point | >110 °C |
| Purity | 97% |
| Density | 1.015 g/mL |
| Appearance | Liquid |
| Application | 1,4-Bis(triethoxysilyl)benzene is a powerful nucleophile that is silicon-based which is shown to be reactive in Pd-catalyzed cross-coupling reactions |
| Storage | Store at room temperature. |
| Chemical Formula | C18H34O6Si2 |
| Exact Mass | 402.18900 |
| MDL Number | MFCD05664351 |
| Physical State | Liquid |
| Refractive Index | 1.4549 |
※ Please kindly noted that this product is for research use only.