1,5-Dichlorohexamethyltrisiloxane

Name: 1,5-Dichlorohexamethyltrisiloxane
SKU: ACM3582716

Catalog NumberACM3582716

CAS Number3582-71-6

CategorySiloxane Compound; Silsesquioxane and Organosilicone

Synonyms	1,5-Dichlorohexamethyltrisiloxane, CID77131, EINECS 222-707-5, TRISILOXANE,1,5-DICHLORO,HEXAMETHYL, 1,5-Dichloro-1,1,3,3,5,5-hexamethyl disiloxane, 1,5-Dichloro-1,1,3,3,5,5-hexamethyltrisiloxane, Trisiloxane, 1,5-dichloro-1,1,3,3,5,5-hexamethyl-, InChI=1/C6H18Cl2O2Si3/c1-11(2,7)9-13(5,6)10-12(3,4)8/h1-6H, 3582-71-6
IUPAC Name	bis[[chloro(dimethyl)silyl]oxy]-dimethylsilane
Molecular Weight	277.37 g/mol
Molecular Formula	C6H18Cl2O2Si3
Canonical SMILES	C[Si](C)(O[Si](C)(C)Cl)O[Si](C)(C)Cl
InChI Key	GJIYNWRLGOMDEX-UHFFFAOYSA-N
Boiling Point	184 °C(760 mmHg)
Melting Point	-53 °C
Flash Point	53.3 °C
Purity	>98.0%(GC)
Density	1.026 g/mL
Appearance	clear colorless liquid
Application	15-Dichlorohexamethyltrisiloxane serves as an essential chemical in the realm of organic synthesis Its distinctive properties make it a valuable compound for facilitating various chemical reactions and processes thereby supporting advancements and innovations in the field of organic chemistry
EC Number	222-707-5
Exact Mass	275.99900
Packaging	10 g; 100 g;
WGK Germany	3