| Catalog Number | ACM185626737 |
|---|---|
| CAS Number | 185626-73-7 |
| Synonyms | 3-Bromotetraphenylsilane |
| IUPAC Name | (3-bromophenyl)-triphenylsilane |
| Molecular Weight | 415.41 |
| Molecular Formula | C24H19BrSi |
| Canonical SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC(=CC=C4)Br |
| InChI | InChI=1S/C24H19BrSi/c25-20-11-10-18-24(19-20)26(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-19H |
| InChI Key | WTYKIOBQNRWDQP-UHFFFAOYSA-N |
| Melting Point | 137 °C |
| Purity | >98.0%(GC) |
| Appearance | White to Light yellow powder to crystal |
| Complexity | 372 |
| Exact Mass | 414.04394g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 26 |
| MDL Number | MFCD28098175 |
| Monoisotopic Mass | 414.04394g/mol |
| Packaging | 250 m g |
| Reaxys Registry Number | 21731604 |
| Rotatable Bond Count | 4 |
※ Please kindly noted that this product is for research use only.