3-Cyclohexenyltrichlorosilane
| Catalog Number | ACM10137696 |
|---|---|
| Product Name | 3-Cyclohexenyltrichlorosilane |
| CAS | 10137-69-6 |
| Structure |  |
| Synonyms | 1-(Trichlorosilyl)-3-cyclohexene; 4-(Trichlorosilyl)cyclohexene |
| IUPAC Name | trichloro(cyclohex-3-en-1-yl)silane |
| Molecular Weight | 215.57 |
| Molecular Formula | C6H9Cl3Si |
| Canonical SMILES | C1CC(CC=C1)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H9Cl3Si/c7-10(8,9)6-4-2-1-3-5-6/h1-2,6H,3-5H2 |
| InChI Key | TTYRJPILQGWBOQ-UHFFFAOYSA-N |
| Boiling Point | 87-88 °C |
| Melting Point | <0 °C |
| Flash Point | 90 °C |
| Density | 1.25 g/cm³ |
| Appearance | Clear to straw liquid |
| Complexity | 138 |
| Exact Mass | 213.953910 |
| Formal Charge | 0 |
| Heavy Atom Count | 10 |
| Hydrogen Bond Acceptor Count | 0 |
| Hydrogen Bond Donor Count | 0 |
| Monoisotopic Mass | 213.953910 |
| Rotatable Bond Count | 0 |
| Topological Polar Surface Area | 0 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
