| Catalog Number | ACM1990509313 |
|---|---|
| CAS Number | 1990509-31-3 |
| Synonyms | Methacrylic Acid 3-(Triallylsilyl)Propyl Ester (Stabilized With Mehq) |
| IUPAC Name | 3-tris(prop-2-enyl)silylpropyl 2-methylprop-2-enoate |
| Molecular Weight | 278.47 |
| Molecular Formula | C16H26O2Si |
| Canonical SMILES | CC(=C)C(=O)OCCC[Si](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C16H26O2Si/c1-6-11-19(12-7-2,13-8-3)14-9-10-18-16(17)15(4)5/h6-8H,1-4,9-14H2,5H3 |
| InChI Key | DZQKPAZSDBDDET-UHFFFAOYSA-N |
| Purity | >92% |
| Appearance | Light yellow to brown clear liquid |
| Complexity | 318 |
| Exact Mass | 278.170207g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Monoisotopic Mass | 278.170207g/mol |
| Rotatable Bond Count | 12 |
| Specific Gravity | 0.93 |
※ Please kindly noted that this product is for research use only.