| Catalog Number | ACM21142290 |
|---|---|
| CAS Number | 21142-29-0 |
| Structure | ![]() |
| Synonyms | 3-Methacryloylxypropyltriethoxysilan; 3-methacryloyloxypropyltriethoxysilane; Triethoxy(3-methacryloyloxypropyl)silane; methacryloxypropyltriethoxysilane; 3-(Triethoxysilyl)propyl methacrylate; Methacrylic Acid 3-(Triethoxysilyl)propyl Ester; |
| IUPAC Name | 3-triethoxysilylpropyl2-methylprop-2-enoate |
| Molecular Weight | 290.43 |
| Molecular Formula | C13H26O5Si |
| Canonical SMILES | CCO[Si](CCCOC(=O)C(=C)C)(OCC)OCC |
| InChI Key | URDOJQUSEUXVRP-UHFFFAOYSA-N |
| Boiling Point | 312 °C (760 mmHg) |
| Flash Point | 118.4 °C |
| Purity | 95% |
| Density | 0.98 g/mL |
| Appearance | Transparent to rice yellow liquid |
| Storage | Below 5ºC |
| EC Number | 244-239-0 |
| Exact Mass | 290.15500 |
| Packaging | 500 g |
| Refractive Index | 1.427 |
※ Please kindly noted that this product is for research use only.