| Catalog Number |
ACM2530850-15 |
| CAS Number |
2530-85-0 |
| Structure |
 |
| Description |
Liquid |
| Synonyms |
Silane A174, [3-(Methacryloyloxy)propyl]trimethoxysilane |
| IUPAC Name |
3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| Molecular Weight |
248.35 |
| Molecular Formula |
H2C=C(CH3)CO2(CH2)3Si(OCH3)3 |
| Canonical SMILES |
CO[Si](CCCOC(=O)C(C)=C)(OC)OC |
| InChI |
1S/C10H20O5Si/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5/h1,6-8H2,2-5H3 |
| InChI Key |
XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| Boiling Point |
190 °C (lit.) |
| Flash Point |
92 °C |
| Purity |
≥97% |
| Density |
1.045 g/mL at 25 °C (lit.) |
| Solubility |
Sol in acetone, benzene, ether, methanol, and hydrocarbons.;In water, 5.5X10+3 mg/L at 25 °C (est) |
| Application |
3-(Trimethoxysilyl)propyl methacrylate (TMSPMA) is a colorless transparent liquid that serves as a functional comonomer in the preparation of polymers such as polystyrene latex in emulsion polymerization. It is commonly used in conjunction with other monomers to create coating, adhesive, and sealing agents with superior adhesion and durability. This hydrophobic monomer can be grafted onto plastic surfaces, thanks to its acrylate functional group, improving mechanical properties in composite materials made from unsaturated polyester. TMSPMA undergoes first-order kinetic polymerization to form polyTMSPMA, a moisture-stable polymer essential for various industrial applications. |
| Storage |
Moisture sensitive |
| Autoignition Temperature |
265 °C ( 509 °F) |
| Complexity |
229 |
| EC Number |
219-785-8 |
| Exact Mass |
248.108g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
16 |
| HS Code |
Non-hazardous for shipping |
| MDL Number |
MFCD00008593 |
| Monoisotopic Mass |
248.108g/mol |
| Packaging |
Packaging
100, 500 mL in Sure/Seal™ |
| Refractive Index |
n20/D 1.431 (lit.) |
| Rotatable Bond Count |
9 |
