| Catalog Number | ACM1150114456 |
|---|---|
| CAS Number | 1150114-45-6 |
| Structure | ![]() |
| Synonyms | 5-(t-Butyldimethylsilyloxy)-2,3-difluorophenylboronic acid, 1150114-45-6, ACMC-2099mi, SureCN2558325, CTK4A9027, ANW-16744, AKOS015837854, AG-D-35672, KB-41148, A-5054, I04-2006, 5-(t-Butyldimethylsilyloxy)-2,3-difluorophenylboronic acid, |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid |
| Molecular Weight | 288.2 |
| Molecular Formula | C12H19BF2O3Si |
| Canonical SMILES | B(C1=CC(=CC(=C1F)F)O[Si](C)(C)C(C)(C)C)(O)O |
| InChI Key | PYVUCBDNFYCJFO-UHFFFAOYSA-N |
| Purity | 0.95 |
| Exact Mass | 288.11600 |
| Packaging | 5 g |
※ Please kindly noted that this product is for research use only.