| Catalog Number |
ACM51895580-4 |
| CAS Number |
51895-58-0 |
| Structure |
 |
| Synonyms |
N-[3-(Trimethoxysilyl)propyl]hexamethylenediamine, N1-[3-(Trimethoxysilyl)propyl]hexane-1,6-diamine, N-(6-Aminohexyl)aminopropyltrimethoxysilane, N-[3-(trimethoxysilyl)propyl]hexane-1,6-diamine, Aminohexylaminopropyltrimethoxysilane |
| IUPAC Name |
N'-(3-trimethoxysilylpropyl)hexane-1,6-diamine |
| Molecular Weight |
278.47 |
| Molecular Formula |
C12H30N2O3Si |
| Canonical SMILES |
CO[Si](CCCNCCCCCCN)(OC)OC |
| InChI |
InChI=1S/C12H30N2O3Si/c1-15-18(16-2,17-3)12-8-11-14-10-7-5-4-6-9-13/h14H,4-13H2,1-3H3 |
| InChI Key |
AMVXVPUHCLLJRE-UHFFFAOYSA-N |
| Boiling Point |
165 °C/0.15 mmHg |
| Purity |
>97.0%(GC)(T) |
| Appearance |
Colorless to light yellow clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
172 |
| Exact Mass |
278.202569g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
18 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00054943 |
| Monoisotopic Mass |
278.202569g/mol |
| Reaxys Registry Number |
9410105 |
| Rotatable Bond Count |
13 |
| Specific Gravity |
0.98 |
