| Catalog Number | ACM4215809-3 |
|---|---|
| CAS Number | 4215-80-9 |
| Structure | ![]() |
| Synonyms | Triphenylsilanamine, Triphenylsilylamine, Aminotriphenylsilane, Triphenylaminosilane, TPSA, 1,1,1-Triphenylsilylamine, 376205_ALDRICH, 93133_FLUKA, MolPort-003-931-270, CID77890, EINECS 224-147-7, 4215-80-9 |
| IUPAC Name | [amino(diphenyl)silyl]benzene |
| Molecular Weight | 275.42 g/mol |
| Molecular Formula | C18H17NSi |
| Canonical SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)N |
| InChI Key | GLQOALGKMKUSBF-UHFFFAOYSA-N |
| Boiling Point | 366.5 °C(760 mmHg) |
| Melting Point | 60-62 °C |
| Flash Point | 175.5 °C |
| Purity | 96% |
| Density | 1.1 g/mL |
| Application | Aminotriphenylsilane serves as a versatile reagent in the synthesis of compounds with significant antimalarial activity such as 2-amino-3-hydroxy-indoles Additionally it is employed in modifying Mo/HZSM-5 catalysts which can influence selectivity in the conversion of methane to benzene This compound is integral to diverse studies including the preparation of specific dimers and triphenylsilylsulfinylamine surface modification of fused silica capillaries and exploring molecular tuning effects through silanation of HZSM-5 crystals Furthermore it is utilized in the synthesis of complex chemical structures like the 9-aminosubstituted derivatives of pyridopyrrolopyrimidine showcasing its broad application in chemical research and development |
| EC Number | 224-147-7 |
| Exact Mass | 275.11300 |
Efficient Reagent for Scientific Research
After using Aminotriphenylsilane for modifying Mo/HZSM-5 catalysts in our MTB reaction studies, we observed improved selectivity and efficiency. Its versatile applications greatly enhance experimental outcomes, making it invaluable for our research.
※ Please kindly noted that this product is for research use only.