| Catalog Number | ACM16654743-1 |
|---|---|
| CAS Number | 16654-74-3 |
| Structure | ![]() |
| Synonyms | Diethylene Glycol Bis(trimethylsilyl Ether) |
| Molecular Weight | 250.49 g/mol |
| Molecular Formula | C10H26O3Si2 |
| Canonical SMILES | C[Si](C)(C)OCCOCCO[Si](C)(C)C |
| Boiling Point | 87 °C(5 mmHg) |
| Flash Point | 72 °C |
| Purity | >98% |
| Appearance | Colorless to Almost colorless clear liquid |
| Chemical Formula | C10H26O3Si2 |
| Reaxys Registry Number | 4175554 |
| Specific Gravity | 0.89 |
※ Please kindly noted that this product is for research use only.