| Catalog Number | ACM18733910-1 |
|---|---|
| CAS Number | 18733-91-0 |
| Synonyms | K0536 |
| IUPAC Name | bis(4-bromophenyl)-diphenylsilane |
| Molecular Weight | 494.3 |
| Molecular Formula | C24H18Br2Si |
| Canonical SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br |
| InChI | InChI=1S/C24H18Br2Si/c25-19-11-15-23(16-12-19)27(21-7-3-1-4-8-21,22-9-5-2-6-10-22)24-17-13-20(26)14-18-24/h1-18H |
| InChI Key | UTEBJTKMYMQRIF-UHFFFAOYSA-N |
| Melting Point | 169 °C |
| Purity | >98.0%(GC) |
| Appearance | White to Almost white powder to crystal |
| Complexity | 397 |
| Exact Mass | 493.9524g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 27 |
| Monoisotopic Mass | 491.95445g/mol |
| Reaxys Registry Number | 3417415 |
| Rotatable Bond Count | 4 |
※ Please kindly noted that this product is for research use only.