| Catalog Number |
ACM17985727-1 |
| CAS Number |
17985-72-7 |
| Structure |
 |
| Synonyms |
1,2-Phenylenebis(dimethylsilane), 1-(2-Bromoethyl)-4-Methylbenzene, Benzene-1,2-Diylbis(Dimethylsilane) |
| IUPAC Name |
[2-(dimethyl-$l^{3}-silanyl)phenyl]-dimethylsilicon |
| Molecular Weight |
194.42 |
| Molecular Formula |
C10H18Si2 |
| Canonical SMILES |
C[Si](C)C1=CC=CC=C1[Si](C)C |
| InChI Key |
MUUXBTFQEXVEEI-UHFFFAOYSA-N |
| Boiling Point |
128 °C/50 mmHg |
| Melting Point |
<25 °C |
| Flash Point |
70 °C |
| Purity |
>94.0%(GC) |
| Density |
0.89 g/mL |
| Appearance |
Colorless to light yellow clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Exact Mass |
194.09500 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00142462 |
| Reaxys Registry Number |
2937027 |
| Specific Gravity |
0.9 |
