| Catalog Number | ACM10536626 |
|---|---|
| CAS Number | 10536-62-6 |
| Structure | ![]() |
| Synonyms | Bis(perfluorophenyl)dimethylsilane |
| IUPAC Name | dimethyl-bis(2,3,4,5,6-pentafluorophenyl)silane |
| Molecular Weight | 392.27 g/mol |
| Molecular Formula | C14H6F10Si |
| Canonical SMILES | C[Si](C)(C1=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F |
| InChI Key | PMUJBDOVBQRNLP-UHFFFAOYSA-N |
| Boiling Point | 92ºC |
| Flash Point | 110.7ºC |
| Purity | >97% |
| Density | 1.4611 |
| Appearance | White to almost white powder to lump |
| Storage | Store under inert gas |
| Exact Mass | 392.00800 |
| MDL Number | MFCD00042066 |
| Reaxys Registry Number | 2955970 |
※ Please kindly noted that this product is for research use only.