| Catalog Number |
ACM13083948-1 |
| CAS Number |
13083-94-8 |
| Structure |
 |
| Synonyms |
1,1'-(1,6-Hexanediyl)bis[1,1,1-trichlorosilane], 1,8-Disilaoctane, 1,1,1,8,8,8-hexachloro-, Hexane-1,6-Diylbis(Trichlorosilane) |
| IUPAC Name |
trichloro(6-trichlorosilylhexyl)silane |
| Molecular Weight |
353.05 g/mol |
| Molecular Formula |
C6H12Cl6Si2 |
| Canonical SMILES |
Cl[Si](Cl)(Cl)CCCCCC[Si](Cl)(Cl)Cl |
| InChI |
1S/C6H12Cl6Si2/c7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-6H2,ICJGKYTXBRDUMV-UHFFFAOYSA-N |
| InChI Key |
ICJGKYTXBRDUMV-UHFFFAOYSA-N |
| Boiling Point |
148-150/10 |
| Melting Point |
<25 °C |
| Flash Point |
75°C |
| Purity |
97% |
| Density |
1.327 g/mL |
| Appearance |
Colorless to light yellow clear liquid |
| Application |
1,6-Bis(trichlorosilyl)hexane is a silane-based cross-linking agent designed for the synthesis of polymeric blended films. These films serve as dielectrics in organic electronic devices such as organic field effect transistors (OFETs) and organic thin film transistors (OTFTs), offering enhanced performance and reliability. |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Chemical Formula |
C6H12Cl6Si2 |
| EC Number |
235-994-7 |
| Exact Mass |
349.86100 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00053189 |
| Reaxys Registry Number |
1768655 |
| Refractive Index |
1.4759 |
| Specific Gravity |
1.33 |
