| Catalog Number |
ACM16068374-3 |
| CAS Number |
16068-37-4 |
| Structure |
 |
| Description |
It is Colorless transparent liquid. |
| Synonyms |
HEXAETHOXYDISILETHYLENE, BSE |
| IUPAC Name |
triethoxy(2-triethoxysilylethyl)silane |
| Molecular Weight |
354.59 g/mol |
| Molecular Formula |
C14H34O6Si2 |
| Canonical SMILES |
CCO[Si](CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI |
InChI=1S/C14H34O6Si2/c1-7-15-21(16-8-2,17-9-3)13-14-22(18-10-4,19-11-5)20-12-6/h7-14H2,1-6H3 |
| InChI Key |
IZRJPHXTEXTLHY-UHFFFAOYSA-N |
| Boiling Point |
96/0.3 |
| Melting Point |
-33°C |
| Flash Point |
107°C |
| Purity |
97% |
| Density |
0.957 g/mL |
| Appearance |
Colorless to almost colorless clear liquid |
| Application |
1,2-Bis(triethoxysilyl)ethane is a colorless transparent liquid used as coating, leather, plastic, surfactant, and textile auxiliary agents. It is also utilized in the preparation of mesoporous organosilica materials and in the amine functionalization of mesoporous silica. Additionally, it can form inorganic hybrid membranes with poly(vinyl alcohol) and has been studied for its effect on the bonding of bis-GMA resin to silicatized titanium. This non-functional silane acts as a double trialkoxysilyl precursor for various applications. |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Chemical Formula |
C14H34O6Si2 |
| Complexity |
208 |
| EC Number |
240-212-2 |
| Exact Mass |
354.189392g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
22 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00239362 |
| Monoisotopic Mass |
354.189392g/mol |
| Reaxys Registry Number |
1792756 |
| Refractive Index |
1.4052 |
| Rotatable Bond Count |
15 |
| Specific Gravity |
0.97 |
