| Catalog Number | ACM87135011-2 |
|---|---|
| CAS Number | 87135-01-1 |
| Structure | ![]() |
| Synonyms | 2,11-Dioxa-3,10-disiladodecane |
| IUPAC Name | trimethoxy(6-trimethoxysilylhexyl)silane |
| Molecular Weight | 326.54 g/mol |
| Molecular Formula | C12H30O6Si2 |
| Canonical SMILES | CO[Si](CCCCCC[Si](OC)(OC)OC)(OC)OC |
| InChI Key | GFKCWAROGHMSTC-UHFFFAOYSA-N |
| Boiling Point | 161/2 |
| Melting Point | <0 °C |
| Flash Point | 95°C |
| Purity | 97% |
| Density | 1.014 g/mL |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Chemical Formula | C12H30O6Si2 |
| EC Number | 617-969-6 |
| Exact Mass | 326.15800 |
| HS Code | 2931900090 |
| MDL Number | MFCD00053853 |
| Refractive Index | 1.4213 |
※ Please kindly noted that this product is for research use only.