| Catalog Number |
ACM82985351-10 |
| CAS Number |
82985-35-1 |
| Structure |
 |
| Description |
Liquid |
| Synonyms |
3,3'-Bis(trimethoxysilyl)dipropylamine |
| IUPAC Name |
3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propan-1-amine |
| Molecular Weight |
341.55 g/mol |
| Molecular Formula |
C12H31NO6Si2 |
| Canonical SMILES |
CO[Si](CCCNCCC[Si](OC)(OC)OC)(OC)OC |
| InChI |
InChI=1S/C12H31NO6Si2/c1-14-20(15-2,16-3)11-7-9-13-10-8-12-21(17-4,18-5)19-6/h13H,7-12H2,1-6H3 |
| InChI Key |
TZZGHGKTHXIOMN-UHFFFAOYSA-N |
| Boiling Point |
152 °C/4 mmHg |
| Purity |
≥95% |
| Appearance |
Colorless to light yellow to light orange clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Chemical Formula |
C12H31NO6Si2 |
| Complexity |
211 |
| EC Number |
280-084-5 |
| Exact Mass |
341.168991g/mol |
| Formal Charge |
0 |
| Hazardous Materials Information |
This is classified as a Dangerous Good for transport and may be subject to additional shipping charges. |
| Heavy Atom Count |
21 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00191835 |
| Monoisotopic Mass |
341.168991g/mol |
| Reaxys Registry Number |
9569446 |
| Rotatable Bond Count |
14 |
| RTECS |
TX2101000 |
| Specific Gravity |
1.05 |
| WGK Germany |
3 |
![N-[3-(Trimethoxysilyl)Propyl]Ethylenediamine](https://resource.alfa-chemistry.com/structure/1760-24-3.gif)
