| Catalog Number |
ACM17151096-1 |
| CAS Number |
17151-09-6 |
| Structure |
 |
| Synonyms |
1,2-Bis(Trimethylsily)Benzene1,2-Bis(Trimethylsilyl)Benzene98%Benzene-1,2-Diylbis(Trimethylsilane) |
| IUPAC Name |
trimethyl-(2-trimethylsilylphenyl)silane |
| Molecular Weight |
222.48 |
| Molecular Formula |
C12H22Si2 |
| Canonical SMILES |
C[Si](C)(C)C1=CC=CC=C1[Si](C)(C)C |
| InChI Key |
YHMJZIJXVNRXIN-UHFFFAOYSA-N |
| Boiling Point |
115ºC (10 mmHg) |
| Flash Point |
90 °C |
| Purity |
>95.0%(GC) |
| Density |
0.91 |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Refrigerated (0-10°C) |
| Condition To Avoid |
Air sensitive, heat sensitive |
| Exact Mass |
222.12600 |
| MDL Number |
MFCD00015590 |
| Pubchem SID |
87565137 |
| Reaxys Registry Number |
2937659 |
| Refractive Index |
1.51 |
| Specific Gravity |
0.91 |
