| Catalog Number | ACM16116782-2 |
|---|---|
| CAS Number | 16116-78-2 |
| Structure | ![]() |
| Synonyms | 2-(4-bromophenyl)ethynyl-trimethyl-silane |
| IUPAC Name | 2-(4-bromophenyl)ethynyl-trimethylsilane |
| Molecular Weight | 253.21 g/mol |
| Molecular Formula | C11H13BrSi |
| Canonical SMILES | C[Si](C)(C)C#CC1=CC=C(C=C1)Br |
| InChI Key | RNMSGCJGNJYDNS-UHFFFAOYSA-N |
| Boiling Point | 247.1 °C(760 mmHg) |
| Melting Point | 62 °C |
| Flash Point | 62 °C |
| Purity | >95.0%(GC) |
| Density | 1.23 g/mL |
| Appearance | White to light yellow powder to crystal |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Chemical Formula | C11H13BrSi |
| Exact Mass | 251.99700 |
| HS Code | 2931900090 |
| MDL Number | MFCD01863556 |
| Reaxys Registry Number | 2830864 |
※ Please kindly noted that this product is for research use only.