| Catalog Number |
ACM18737401-1 |
| CAS Number |
18737-40-1 |
| Structure |
 |
| Synonyms |
Benzene,1-bromo-4-(triphenylsilyl)- |
| IUPAC Name |
(4-bromophenyl)-triphenylsilane |
| Molecular Weight |
415.41 |
| Molecular Formula |
C24H19BrSi |
| Canonical SMILES |
C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=C(C=C4)Br |
| InChI |
InChI=1S/C24H19BrSi/c25-20-16-18-24(19-17-20)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19H |
| InChI Key |
UDZSLJULKCKKPX-UHFFFAOYSA-N |
| Boiling Point |
175 °C |
| Melting Point |
462.9 ± 37.0 °C |
| Flash Point |
359.1 °C |
| Purity |
>96.0%(GC) |
| Density |
1.30 ± 0.1 g/ml |
| Appearance |
White to almost white powder to crystal |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Condition To Avoid |
Moisture sensitive |
| Pubchem SID |
87560813 |
| Reaxys Registry Number |
2992351 |
