| Catalog Number |
ACM3634671-2 |
| CAS Number |
3634-67-1 |
| Structure |
 |
| Molecular Weight |
319.04 g/mol |
| Molecular Formula |
C18H39ClSi |
| Canonical SMILES |
CCCCCC[Si](CCCCCC)(CCCCCC)Cl |
| Boiling Point |
153.5-154°C(lit.) at 5 mmHg |
| Flash Point |
188.6 °C |
| Purity |
97% |
| Density |
0.871 g/mL at 25°C (lit.) |
| Appearance |
Colorless to Light yellow clear liquid |
| Application |
Chlorotrihexylsilane serves as a surface modifier designed to optimize the dispersion of phosphor within polymeric matrices By employing surface modification this product effectively enhances the integration and uniform distribution of phosphor resulting in improved performance and functionality in various applications |
| Storage |
Desiccate at room temperature. |
| Chemical Formula |
C18H39ClSi |
| EC Number |
222-851-9 |
| Hazardous Materials Information |
This is classified as a Dangerous Good for transport and may be subject to additional shipping charges. |
| MDL Number |
MFCD00000510 |
| Physical State |
Liquid |
| Reaxys Registry Number |
1763434 |
| Specific Gravity |
0.87 |
