| Catalog Number | ACM558634 |
|---|---|
| CAS Number | 558-63-4 |
| Structure | ![]() |
| Synonyms | Silane, bis(1,1-dimethylethyl)difluoro- |
| IUPAC Name | ditert-butyl(difluoro)silane |
| Molecular Weight | 180.31 |
| Molecular Formula | C8H18F2Si |
| Canonical SMILES | CC(C)(C)[Si](C(C)(C)C)(F)F |
| InChI | InChI=1S/C8H18F2Si/c1-7(2,3)11(9,10)8(4,5)6/h1-6H3 |
| InChI Key | WGAZDTADWBWCGU-UHFFFAOYSA-N |
| Boiling Point | 134 °C |
| Melting Point | <0 °C |
| Flash Point | <60 °C |
| Purity | 97% |
| Density | 0.869±0.06 g/cm³ (Predicted) |
| Appearance | Clear to straw liquid |
| Complexity | 123 |
| Exact Mass | 180.11458343 |
| Formal Charge | 0 |
| Heavy Atom Count | 11 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 0 |
| MDL Number | MFCD09909988 |
| Monoisotopic Mass | 180.11458343 |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 0 Ų |
※ Please kindly noted that this product is for research use only.