| Catalog Number |
ACM478190793-1 |
| CAS Number |
478190-79-3 |
| Synonyms |
[(2,5-Dibromo-1,4-phenylene)bis(ethyne-2,1-diyl)]bis(trimethylsilane), [2-[2,5-Dibromo-4-[2-(trimethylsilyl)ethynyl]phenyl]ethynyl]trimethylsilane |
| IUPAC Name |
2-[2,5-dibromo-4-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| Molecular Weight |
428.31 |
| Molecular Formula |
C16H20Br2Si2 |
| Canonical SMILES |
C[Si](C)(C)C#CC1=CC(=C(C=C1Br)C#C[Si](C)(C)C)Br |
| InChI |
InChI=1S/C16H20Br2Si2/c1-19(2,3)9-7-13-11-16(18)14(12-15(13)17)8-10-20(4,5)6/h11-12H,1-6H3 |
| InChI Key |
TUMMIWKEWMEYTF-UHFFFAOYSA-N |
| Melting Point |
121 °C |
| Flash Point |
121 °C |
| Purity |
>98.0%(GC) |
| Solubility |
Soluble in Chloroform. |
| Appearance |
White to light yellow powder to crystal |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
427 |
| Exact Mass |
427.94498g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
20 |
| HS Code |
2931900090 |
| MDL Number |
MFCD11521283 |
| Monoisotopic Mass |
425.94703g/mol |
| Reaxys Registry Number |
9146549 |
| Rotatable Bond Count |
4 |
