| Catalog Number |
ACM1030856973-1 |
| CAS Number |
1030856-97-3 |
| Structure |
 |
| Synonyms |
3,5-Dibromotetraphenylsilane |
| IUPAC Name |
(3,5-dibromophenyl)-triphenylsilane |
| Molecular Weight |
494.30 |
| Molecular Formula |
C24H18Br2Si |
| Canonical SMILES |
C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC(=CC(=C4)Br)Br |
| InChI |
InChI=1S/C24H18Br2Si/c25-19-16-20(26)18-24(17-19)27(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-18H |
| InChI Key |
UYGFDYMFXPXXLL-UHFFFAOYSA-N |
| Melting Point |
188 °C |
| Purity |
>98.0%(GC) |
| Appearance |
White to light yellow powder to crystal |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Complexity |
394 |
| Exact Mass |
493.9524g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
27 |
| Monoisotopic Mass |
491.95445g/mol |
| Pubchem SID |
354334775 |
| Reaxys Registry Number |
24052420 |
| Rotatable Bond Count |
4 |
