| Catalog Number |
ACM775564-5 |
| CAS Number |
775-56-4 |
| Structure |
 |
| Synonyms |
MethylphenyldiethoxysilanePhenylmethyldiethoxysilaneDiethoxymethylphenyl-Silan |
| IUPAC Name |
diethoxy-methyl-phenylsilane |
| Molecular Weight |
210.34 g/mol |
| Molecular Formula |
C11H18O2Si |
| Canonical SMILES |
CCO[Si](C)(C1=CC=CC=C1)OCC |
| InChI |
InChI=1S/C11H18O2Si/c1-4-12-14(3,13-5-2)11-9-7-6-8-10-11/h6-10H,4-5H2,1-3H3 |
| InChI Key |
MNFGEHQPOWJJBH-UHFFFAOYSA-N |
| Boiling Point |
218 °C |
| Flash Point |
89 °C |
| Purity |
>97.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Chemical Formula |
C11H18O2Si |
| Complexity |
149 |
| Condition To Avoid |
Moisture sensitive |
| Exact Mass |
210.107606g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
14 |
| MDL Number |
MFCD00048541 |
| Monoisotopic Mass |
210.107606g/mol |
| Pubchem SID |
87560951 |
| Reaxys Registry Number |
2938396 |
| Refractive Index |
1.47 |
| Rotatable Bond Count |
5 |
| Specific Gravity |
0.97 |
