| Catalog Number | ACM2553197-2 |
|---|---|
| CAS Number | 2553-19-7 |
| Structure | ![]() |
| Synonyms | Diphenyl diethyloxysilane |
| IUPAC Name | Diethoxy(diphenyl)silane |
| Molecular Weight | 272.42 |
| Molecular Formula | C16H20O2Si |
| Canonical SMILES | CCO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC |
| InChI | InChI=1S/C16H20O2Si/c1-3-17-19(18-4-2,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChI Key | ZZNQQQWFKKTOSD-UHFFFAOYSA-N |
| Boiling Point | 218 °C/100 mmHg |
| Flash Point | 175 °C |
| Purity | >98.0%(GC) |
| Density | 1.033 g/mL at 25 °C (lit.) |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Room temperature (Recommended in a cool and dark place, <15°C) |
| Complexity | 219 |
| Condition To Avoid | Moisture sensitive |
| Exact Mass | 272.123256411 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| MDL Number | MFCD00015126 |
| Monoisotopic Mass | 272.123256411 |
| Pubchem SID | 87559439 |
| Reaxys Registry Number | 2281302 |
| Refractive Index | 1.53 |
| Rotatable Bond Count | 6 |
| Specific Gravity | 1.03 |
| Topological Polar Surface Area | 18.5 Ų |
※ Please kindly noted that this product is for research use only.