| Catalog Number | ACM15180479 |
|---|---|
| CAS Number | 15180-47-9 |
| Structure | ![]() |
| Synonyms | (Triethoxysilylmethyl)diethylamine |
| IUPAC Name | N-ethyl-N-(triethoxysilylmethyl)ethanamine |
| Molecular Weight | 249.422 g/mol |
| Molecular Formula | C11H27NO3Si |
| Canonical SMILES | CCN(CC)C[Si](OCC)(OCC)OCC |
| InChI Key | UMXXGDJOCQSQBV-UHFFFAOYSA-N |
| Boiling Point | 110-130°C (5 mmHg) |
| Flash Point | 97ºC |
| Purity | ≥95% |
| Density | 0.916-0.935 g/mL |
| Appearance | Colorless to pale yellow transparent liquid, slightly odor |
| Exact Mass | 249.17600 |
| Packaging | 180 Kg / iron barrel |
※ Please kindly noted that this product is for research use only.