| Catalog Number |
ACM17882949-1 |
| CAS Number |
17882-94-9 |
| Structure |
 |
| Synonyms |
Bis(ethyldimethylsilyl)amine |
| IUPAC Name |
[[[Ethyl(dimethyl)silyl]amino]-dimethylsilyl]ethane |
| Molecular Weight |
189.45 g/mol |
| Molecular Formula |
C8H23NSi2 |
| Canonical SMILES |
CC[Si](C)(C)N[Si](C)(C)CC |
| InChI |
InChI=1S/C8H23NSi2/c1-7-10(3,4)9-11(5,6)8-2/h9H,7-8H2,1-6H3 |
| InChI Key |
MHRNQQUEUYMEEH-UHFFFAOYSA-N |
| Boiling Point |
37-39°C(lit.) |
| Flash Point |
55 °C |
| Purity |
95%+ |
| Density |
0.817 g/mL at 25°C |
| Appearance |
Liquid |
| Storage |
Store at room temperature. |
| Chemical Formula |
C8H23NSi2 |
| Complexity |
107 |
| Exact Mass |
189.13690281 |
| Formal Charge |
0 |
| Hazardous Materials Information |
This is classified as a Dangerous Good for transport and may be subject to additional shipping charges. |
| Heavy Atom Count |
11 |
| MDL Number |
MFCD00054742 |
| Monoisotopic Mass |
189.13690281 |
| Packaging |
10 g; 100 g; |
| Physical State |
Liquid |
| Rotatable Bond Count |
4 |
| Topological Polar Surface Area |
12 Ų |
