| Catalog Number |
ACM121177933-1 |
| CAS Number |
121177-93-3 |
| Structure |
 |
| Synonyms |
Methacrylic Acid [Dimethoxy(Methyl)Silyl]Methyl Ester (Stabilized With Bht) |
| IUPAC Name |
[dimethoxy(methyl)silyl]methyl 2-methylprop-2-enoate |
| Molecular Weight |
204.3 |
| Molecular Formula |
C8H16O4Si |
| Canonical SMILES |
CC(=C)C(=O)OC[Si](C)(OC)OC |
| InChI |
InChI=1S/C8H16O4Si/c1-7(2)8(9)12-6-13(5,10-3)11-4/h1,6H2,2-5H3 |
| InChI Key |
YBUIRAZOPRQNDE-UHFFFAOYSA-N |
| Flash Point |
62 °C |
| Purity |
>90% |
| Appearance |
Colorless to Almost colorless clear liquid |
| Storage |
Store under inert gas |
| Complexity |
198 |
| Exact Mass |
204.081786g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
13 |
| MDL Number |
MFCD07777082 |
| Monoisotopic Mass |
204.081786g/mol |
| Reaxys Registry Number |
9389490 |
| Rotatable Bond Count |
6 |
| Specific Gravity |
1.02 |
