| Catalog Number |
ACM13732008-7 |
| CAS Number |
13732-00-8 |
| Structure |
 |
| Synonyms |
Acrylic Acid 3-[Dimethoxy(methyl)silyl]propyl Ester (stabilized with MEHQ) |
| IUPAC Name |
3-[dimethoxy(methyl)silyl]propyl prop-2-enoate |
| Molecular Weight |
218.32 |
| Molecular Formula |
C9H18O4Si |
| Canonical SMILES |
CO[Si](C)(CCCOC(=O)C=C)OC |
| InChI |
InChI=1S/C9H18O4Si/c1-5-9(10)13-7-6-8-14(4,11-2)12-3/h5H,1,6-8H2,2-4H3 |
| InChI Key |
MCDBEBOBROAQSH-UHFFFAOYSA-N |
| Flash Point |
82 °C |
| Purity |
>95.0%(GC) |
| Appearance |
Colorless to light yellow clear liquid |
| Storage |
Refrigerated (0-10°C) |
| Complexity |
189 |
| Condition To Avoid |
Light sensitive, heat sensitive |
| Exact Mass |
218.097436g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
14 |
| MDL Number |
MFCD00156431 |
| Monoisotopic Mass |
218.097436g/mol |
| Pubchem SID |
468591407 |
| Reaxys Registry Number |
11521972 |
| Rotatable Bond Count |
8 |
| Specific Gravity |
1.02 |
