| Catalog Number | ACM13732008-7 |
|---|---|
| CAS Number | 13732-00-8 |
| Synonyms | Acrylic Acid 3-[Dimethoxy(methyl)silyl]propyl Ester (stabilized with MEHQ) |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propyl prop-2-enoate |
| Molecular Weight | 218.32 |
| Molecular Formula | C9H18O4Si |
| Canonical SMILES | CO[Si](C)(CCCOC(=O)C=C)OC |
| InChI | InChI=1S/C9H18O4Si/c1-5-9(10)13-7-6-8-14(4,11-2)12-3/h5H,1,6-8H2,2-4H3 |
| InChI Key | MCDBEBOBROAQSH-UHFFFAOYSA-N |
| Flash Point | 82 °C |
| Purity | >95.0%(GC) |
| Appearance | Colorless to light yellow clear liquid |
| Storage | Refrigerated (0-10°C) |
| Complexity | 189 |
| Condition To Avoid | Light sensitive, heat sensitive |
| Exact Mass | 218.097436g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| MDL Number | MFCD00156431 |
| Monoisotopic Mass | 218.097436g/mol |
| Pubchem SID | 468591407 |
| Reaxys Registry Number | 11521972 |
| Rotatable Bond Count | 8 |
| Specific Gravity | 1.02 |
※ Please kindly noted that this product is for research use only.