| Catalog Number |
ACM6843669-3 |
| CAS Number |
6843-66-9 |
| Structure |
 |
| Description |
Liquid |
| Synonyms |
Diphenyldimethoxysilane |
| IUPAC Name |
dimethoxy(diphenyl)silane |
| Molecular Weight |
244.36 g/mol |
| Molecular Formula |
C14H16O2Si |
| Canonical SMILES |
CO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC |
| InChI |
InChI=1S/C14H16O2Si/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChI Key |
AHUXYBVKTIBBJW-UHFFFAOYSA-N |
| Boiling Point |
110 °C/1 mmHg |
| Flash Point |
157 °C |
| Purity |
>98.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Chemical Formula |
C14H16O2Si |
| Complexity |
196 |
| Condition To Avoid |
Moisture sensitive |
| Exact Mass |
244.091956g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
17 |
| MDL Number |
MFCD00025690 |
| Monoisotopic Mass |
244.091956g/mol |
| Pubchem SID |
87568203 |
| Reaxys Registry Number |
2940458 |
| Refractive Index |
1.54 |
| Rotatable Bond Count |
4 |
| Specific Gravity |
1.08 |
