| Catalog Number |
ACM1172765-1 |
| CAS Number |
1172-76-5 |
| Structure |
 |
| Synonyms |
Disilane, 1,2-dimethyl-1,1,2,2-tetraphenyl- |
| IUPAC Name |
methyl-[methyl(diphenyl)silyl]-diphenylsilane |
| Molecular Weight |
394.66 g/mol |
| Molecular Formula |
C26H26Si2 |
| Canonical SMILES |
C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)[Si](C)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI |
InChI=1S/C26H26Si2/c1-27(23-15-7-3-8-16-23,24-17-9-4-10-18-24)28(2,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChI Key |
JNZRJYXUMDPPRK-UHFFFAOYSA-N |
| Boiling Point |
185 °C/1 mmHg |
| Melting Point |
144 °C |
| Flash Point |
144 °C |
| Purity |
>98.0%(GC) |
| Density |
1.05 g/mL |
| Solubility |
Soluble in Toluene. |
| Appearance |
White to almost white powder to crystal |
| Application |
1,2-Dimethyl-1,1,2,2-tetraphenyldisilane is a disilane compound for proteomics research |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Chemical Formula |
C26H26Si2 |
| Complexity |
383 |
| Exact Mass |
394.157304g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
28 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00051536 |
| Monoisotopic Mass |
394.157304g/mol |
| Reaxys Registry Number |
2949874 |
| Rotatable Bond Count |
5 |
