| Catalog Number | ACM68733631-2 |
|---|---|
| CAS Number | 68733-63-1 |
| Structure | ![]() |
| IUPAC Name | benzhydryl(dimethylamino)silicon |
| Molecular Weight | 232.78 g/mol |
| Molecular Formula | C15H19NSi |
| Canonical SMILES | CN(C)[Si]C(C1=CC=CC=C1)C2=CC=CC=C2 |
| InChI Key | UNABZXTYLUMNPZ-UHFFFAOYSA-N |
| Boiling Point | 98-99/0.25 |
| Flash Point | 75 °C |
| Purity | 97% |
| Density | 1.011 g/mL |
| Appearance | Straw liquid |
| Storage | Storage conditions: Keep container tightly closed. Store in sealed containers under a dry inert atmosphere of |
| Chemical Formula | C15H19NSi |
| Exact Mass | 241.12900 |
※ Please kindly noted that this product is for research use only.