| Catalog Number | ACM1450299-1 |
|---|---|
| CAS Number | 1450-29-9 |
| Structure | ![]() |
| Synonyms | 1,1,2,2-Tetramethyl-1,2-divinyldisilane, 1,2-Diethenyl-1,1,2,2-Tetramethyldisilane, 1,2-Divinyl-1,1,2,2-tetramethyldisilane, 1,2-Divinyltetramethyldisilane |
| IUPAC Name | bis(ethenyl)-methyl-trimethylsilylsilane |
| Molecular Weight | 170.4 |
| Molecular Formula | C8H18Si2 |
| Canonical SMILES | C[Si](C)(C)[Si](C)(C=C)C=C |
| InChI Key | SSKBZCXSHBXUFK-UHFFFAOYSA-N |
| Boiling Point | 55 °C/21 mmHg |
| Flash Point | 29.4ºC |
| Purity | 92% |
| Density | 0.766g/cm³ |
| Appearance | Liquid |
| Storage | Storage conditions: Keep container tightly closed. Keep in a cool place. Store in sealed containers in the dark. |
| Exact Mass | 170.09500 |
※ Please kindly noted that this product is for research use only.