| Catalog Number | ACM17689779-6 |
|---|---|
| CAS Number | 17689-77-9 |
| Description | Triacetoxysilyl ethyl does not contain any additives such as catalysts, stabilizers or adhesion promoters. Usually used as a curing agent. |
| Synonyms | Ethyltriacetoxysilane; [diacetyloxy(ethyl)silyl] acetate; Triacetoxy(Ethyl)Silane; (Triacetoxy)ethylsilane; |
| IUPAC Name | [diacetyloxy(ethyl)silyl]acetate |
| Molecular Weight | 243.28 g/mol |
| Molecular Formula | C8H14O6Si |
| Canonical SMILES | CC[Si](OC(=O)C)(OC(=O)C)OC(=O)C |
| InChI Key | KXJLGCBCRCSXQF-UHFFFAOYSA-N |
| Boiling Point | 107-108/8 |
| Melting Point | 7-9°C |
| Flash Point | 106°C |
| Purity | 97% |
| Density | 1.143 g/mL |
| Appearance | Transparent liquid |
| Storage | Be airtight in a cool and dry environment. |
| Chemical Formula | C8H14O6Si |
| EC Number | 241-677-4 |
| Exact Mass | 234.05600 |
| Packaging | 10 g; 100 g; |
| Refractive Index | 1.4123 |
| WGK Germany | 3 |
※ Please kindly noted that this product is for research use only.