| Catalog Number |
ACM13465775-1 |
| CAS Number |
13465-77-5 |
| Structure |
 |
| Synonyms |
1,1,1,2,2,2-Hexachlorodisilane; Disilicon hexachloride; HCDS |
| IUPAC Name |
Trichloro(trichlorosilyl)silane |
| Molecular Weight |
268.89 g/mol |
| Molecular Formula |
Cl6Si2 |
| Canonical SMILES |
[Si]([Si](Cl)(Cl)Cl)(Cl)(Cl)Cl |
| InChI |
InChI=1S/Cl6Si2/c1-7(2,3)8(4,5)6 |
| InChI Key |
LXEXBJXDGVGRAR-UHFFFAOYSA-N |
| Boiling Point |
144-145.5°C(lit.) |
| Melting Point |
-1.19°C |
| Flash Point |
78 °C |
| Purity |
>98.0%(T) |
| Density |
1.562 g/mL at 25°C |
| Appearance |
Colorless to almost colorless clear liquid |
| Application |
Hexachlorodisilane is a versatile and valuable tool in various chemical processes. It serves as a powerful reducing agent in the deoxygenation and desulfurization of phosphine oxides, phosphine sulfides, and amine oxides. Additionally, it can be used for reducing nitro groups and sulfur diimides. When combined with ammonia, it enables the formation of silicon nitride through chemical vapor deposition techniques. This colourless liquid, also known as HCDS, acts as a precursor in the production of disilanes and plays a crucial role in the creation of silicon films and silicon nitride based films. |
| Storage |
Store at room temperature. |
| Chemical Formula |
(SiCl3)2 |
| Complexity |
61.5 |
| EC Number |
236-704-1 |
| Exact Mass |
267.764019 |
| Heavy Atom Count |
8 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00011599 |
| Monoisotopic Mass |
267.764019 |
| Physical State |
Liquid |
| Reaxys Registry Number |
3535986 |
| Specific Gravity |
1.55 |
| Topological Polar Surface Area |
0 Ų |
