| Catalog Number | ACM1450233-1 |
|---|---|
| CAS Number | 1450-23-3 |
| Structure | ![]() |
| Synonyms | 1,1,1,2,2,2-Hexaphenyldisilane, Disilane, 1,1,1,2,2,2-hexaphenyl- |
| IUPAC Name | triphenyl(triphenylsilyl)silane |
| Molecular Weight | 518.81 |
| Molecular Formula | C36H30Si2 |
| Canonical SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6 |
| InChI Key | ZMHATUZXFSOVSC-UHFFFAOYSA-N |
| Boiling Point | 578 °C(760 mmHg) |
| Melting Point | 358-360 °C |
| Flash Point | 279.3 °C |
| Purity | >97.0%(GC) |
| Density | mp 368-70 °C g/mL |
| Appearance | White to almost white powder to crystal |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Exact Mass | 518.18900 |
| HS Code | 2931900090 |
| MDL Number | MFCD00039558 |
| Reaxys Registry Number | 2024230 |
※ Please kindly noted that this product is for research use only.