| Catalog Number | ACM1829409-2 |
|---|---|
| CAS Number | 1829-40-9 |
| Synonyms | Disiloxane,1,1,1,3,3,3-Hexaphenyl-Bis(Triphenylsilyl)Ethernsc12574Disiloxane,Hexaphenyl- |
| IUPAC Name | triphenyl(triphenylsilyloxy)silane |
| Molecular Weight | 534.79 g/mol |
| Molecular Formula | C36H30OSi2 |
| Canonical SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)O[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6 |
| InChI Key | IVZTVZJLMIHPEY-UHFFFAOYSA-N |
| Boiling Point | 494 °C |
| Melting Point | -225 °C |
| Flash Point | >200 °C |
| Purity | >96% |
| Density | 1.2 g/mL |
| Appearance | White to almost white powder to crystal |
| Chemical Formula | C36H30OSi2 |
| EC Number | 217-381-6 |
| Exact Mass | 534.18400 |
| MDL Number | MFCD00014068 |
| Packaging | 10 g; 100 g; |
| Reaxys Registry Number | 1334807 |
| Refractive Index | 1.68 |
| WGK Germany | 3 |
※ Please kindly noted that this product is for research use only.