| Catalog Number |
ACM752283 |
| CAS Number |
752-28-3 |
| Synonyms |
1,1,2,3,4,5-Hexaphenylsilacyclopenta-2,4-diene |
| IUPAC Name |
1,1,2,3,4,5-hexakis-phenylsilole |
| Molecular Weight |
538.77 |
| Molecular Formula |
C40H30Si |
| Canonical SMILES |
C1=CC=C(C=C1)C2=C([Si](C(=C2C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7 |
| InChI |
InChI=1S/C40H30Si/c1-7-19-31(20-8-1)37-38(32-21-9-2-10-22-32)40(34-25-13-4-14-26-34)41(35-27-15-5-16-28-35,36-29-17-6-18-30-36)39(37)33-23-11-3-12-24-33/h1-30H |
| InChI Key |
QAKMXYFDVPDIPT-UHFFFAOYSA-N |
| Boiling Point |
193.0 - 197.0 °C |
| Melting Point |
674.1 ± 55.0 °C |
| Purity |
>98.0%(GC) |
| Density |
1.18 ± 0.1 g/ml |
| Appearance |
White to yellow to green powder to crystal |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Complexity |
827 |
| Condition To Avoid |
Air Sensitive |
| Exact Mass |
538.211677g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
41 |
| Monoisotopic Mass |
538.211677g/mol |
| Pubchem SID |
253660157 |
| Reaxys Registry Number |
61127 |
| Rotatable Bond Count |
6 |
