| Catalog Number | ACM1332587-21 |
|---|---|
| CAS Number | 1332-58-7 |
| Synonyms | Aluminum silicate hydroxide |
| Molecular Weight | 258.16 g/mol |
| Canonical SMILES | O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
| Density | 2.65 g/mL |
| Solubility | Insoluble in water, ether, dilute acids, and alkali hydroxides. |
| Application | Kaolin is a hydrated aluminum silicate |
| Storage | Store at room temperature. |
| Chemical Formula | Al2Si2O7·2H2O |
| EC Number | 310-194-1 |
| MDL Number | MFCD00062311 |
| Physical State | Solid |
| RTECS | GF1670500 |
| WGK Germany | nwg |
※ Please kindly noted that this product is for research use only.