| Catalog Number |
ACM128388534-3 |
| CAS Number |
128388-53-4 |
| Structure |
 |
| Synonyms |
3,5-Diphenyl-1-trimethylsilylbenzene, Trimethyl( m -terphenyl-5'-yl)silane |
| IUPAC Name |
(3,5-diphenylphenyl)-trimethylsilane |
| Molecular Weight |
302.49 |
| Molecular Formula |
C21H22Si |
| Canonical SMILES |
C[Si](C)(C)C1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI |
InChI=1S/C21H22Si/c1-22(2,3)21-15-19(17-10-6-4-7-11-17)14-20(16-21)18-12-8-5-9-13-18/h4-16H,1-3H3 |
| InChI Key |
GCYRLUSIWVFXEZ-UHFFFAOYSA-N |
| Melting Point |
81 °C |
| Purity |
>98.0%(GC) |
| Appearance |
White to almost white powder to crystal |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Complexity |
304 |
| Condition To Avoid |
Moisture sensitive |
| Exact Mass |
302.149077g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
22 |
| MDL Number |
MFCD03844807 |
| Monoisotopic Mass |
302.149077g/mol |
| Pubchem SID |
87577594 |
| Reaxys Registry Number |
4868239 |
| Rotatable Bond Count |
3 |
