| Catalog Number |
ACM904704230-1 |
| CAS Number |
904704-23-0 |
| Structure |
 |
| Synonyms |
3-[Bis[(diphenylphosphino)methyl]amino]propyltriethoxysilane |
| IUPAC Name |
N,N-bis(diphenylphosphanylmethyl)-3-triethoxysilylpropan-1-amine |
| Molecular Weight |
617.78 |
| Molecular Formula |
C35H45NO3P2Si |
| Canonical SMILES |
CCO[Si](CCCN(CP(C1=CC=CC=C1)C2=CC=CC=C2)CP(C3=CC=CC=C3)C4=CC=CC=C4)(OCC)OCC |
| InChI |
InChI=1S/C35H45NO3P2Si/c1-4-37-42(38-5-2,39-6-3)29-19-28-36(30-40(32-20-11-7-12-21-32)33-22-13-8-14-23-33)31-41(34-24-15-9-16-25-34)35-26-17-10-18-27-35/h7-18,20-27H,4-6,19,28-31H2,1-3H3 |
| InChI Key |
COWAWBPCENPPGN-UHFFFAOYSA-N |
| Flash Point |
336 °C |
| Purity |
>95.0%(N) |
| Appearance |
Colorless to light yellow to light orange clear liquid |
| Storage |
Refrigerated (0-10 °C) |
| Complexity |
599 |
| Exact Mass |
617.26439483 |
| Formal Charge |
0 |
| Heavy Atom Count |
42 |
| HS Code |
2931900090 |
| Hydrogen Bond Acceptor Count |
4 |
| Hydrogen Bond Donor Count |
0 |
| MDL Number |
MFCD31618108 |
| Monoisotopic Mass |
617.26439483 |
| Rotatable Bond Count |
18 |
| Topological Polar Surface Area |
30.9 Ų |
