| Catalog Number | ACM904704230-1 |
|---|---|
| CAS Number | 904704-23-0 |
| Structure | ![]() |
| Synonyms | 3-[Bis[(diphenylphosphino)methyl]amino]propyltriethoxysilane |
| IUPAC Name | N,N-bis(diphenylphosphanylmethyl)-3-triethoxysilylpropan-1-amine |
| Molecular Weight | 617.78 |
| Molecular Formula | C35H45NO3P2Si |
| Canonical SMILES | CCO[Si](CCCN(CP(C1=CC=CC=C1)C2=CC=CC=C2)CP(C3=CC=CC=C3)C4=CC=CC=C4)(OCC)OCC |
| InChI | InChI=1S/C35H45NO3P2Si/c1-4-37-42(38-5-2,39-6-3)29-19-28-36(30-40(32-20-11-7-12-21-32)33-22-13-8-14-23-33)31-41(34-24-15-9-16-25-34)35-26-17-10-18-27-35/h7-18,20-27H,4-6,19,28-31H2,1-3H3 |
| InChI Key | COWAWBPCENPPGN-UHFFFAOYSA-N |
| Flash Point | 336 °C |
| Purity | >95.0%(N) |
| Appearance | Colorless to light yellow to light orange clear liquid |
| Storage | Refrigerated (0-10 °C) |
| Complexity | 599 |
| Exact Mass | 617.26439483 |
| Formal Charge | 0 |
| Heavy Atom Count | 42 |
| HS Code | 2931900090 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| MDL Number | MFCD31618108 |
| Monoisotopic Mass | 617.26439483 |
| Rotatable Bond Count | 18 |
| Topological Polar Surface Area | 30.9 Ų |
※ Please kindly noted that this product is for research use only.