| Catalog Number |
ACM53215955-3 |
| CAS Number |
53215-95-5 |
| Structure |
 |
| Synonyms |
Silane Benzyl-Tmsma, N-Benzylaminomethyltrimethylsilane, N-(Trimethylsilylmethyl)Benzyamine, 1-phenyl-N-[(trimethylsilyl)methyl]methanamine, N-[(trimethylsilyl)methyl]aniline |
| IUPAC Name |
1-phenyl-N-(trimethylsilylmethyl)methanamine |
| Molecular Weight |
193.37 |
| Molecular Formula |
C11H19NSi |
| Canonical SMILES |
C[Si](C)(C)CNCC1=CC=CC=C1 |
| InChI Key |
WECLUYCAWLJMKM-UHFFFAOYSA-N |
| Boiling Point |
71 °C/0.7 mmHg |
| Flash Point |
96 °C |
| Purity |
>96.0%(GC)(T) |
| Density |
0.893 g/mL |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Exact Mass |
193.12900 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00012192 |
