Catalog Number | ACM1206468 |
---|---|
CAS Number | 1206-46-8 |
Synonyms | Trimethyl(pentafluorophenyl)silane |
IUPAC Name | trimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
Molecular Weight | 240.25 g/mol |
Molecular Formula | C9H9F5Si |
Canonical SMILES | C[Si](C)(C)C1=C(C(=C(C(=C1F)F)F)F)F |
InChI Key | GABHTFORECKGBB-UHFFFAOYSA-N |
Boiling Point | 129.5 °C(760 mmHg) |
Flash Point | 32.1 °C |
Purity | 95%+ |
Density | 1.2 g/mL |
Appearance | Straw Liquid |
Application | Pentafluorophenyltrimethylsilane serves as a valuable reagent in the realm of organic chemistry facilitating a wide range of reactions due to its unique chemical properties |
Exact Mass | 240.03900 |
Packaging | 10 g; 100 g; |
WGK Germany | 3 |
Highly Effective Reagent for Organic Synthesis
Pentafluorophenyltrimethylsilane proved invaluable in our research facilitating smooth organic reactions Its stability and efficiency significantly enhanced our experimental outcomes making it a reliable choice for complex synthesis processes in our lab
※ Please kindly noted that this product is for research use only.