| Catalog Number | ACM181231685-1 |
|---|---|
| CAS Number | 181231-68-5 |
| Structure | ![]() |
| Synonyms | N-[dimethyl(phenethyl)silyl]-N-methyl-methanamine |
| IUPAC Name | N-[dimethyl(2-phenylethyl)silyl]-N-methylmethanamine |
| Molecular Weight | 207.39 g/mol |
| Molecular Formula | C12H21NSi |
| Canonical SMILES | CN(C)[Si](C)(C)CCC1=CC=CC=C1 |
| InChI Key | CWXWPIUMYLZIME-UHFFFAOYSA-N |
| Boiling Point | 109/2 |
| Flash Point | >65 °C |
| Purity | 97% |
| Density | 0.890 g/mL |
| Appearance | Straw liquid |
| Storage | Storage conditions: Keep container tightly closed. Store in sealed containers under a dry inert atmosphere of |
| Chemical Formula | C12H21NSi |
| Exact Mass | 207.14400 |
| Refractive Index | 1.4946 |
※ Please kindly noted that this product is for research use only.