| Catalog Number |
ACM940410-3 |
| CAS Number |
940-41-0 |
| Structure |
 |
| Synonyms |
(2-Phenethyl)-trichlorosilane, (2-Phenylethyl)trichlorosilane, 1-(Trichlorosilyl)-2-phenylethane, 1-Phenyl-2-(trichlorosilyl)ethane, 2-(Trichlorosilyl)ethylbenzene, 3-Phenethyltrichlorosilane |
| IUPAC Name |
Trichloro(2-phenylethyl)silane |
| Molecular Weight |
239.60 g/mol |
| Molecular Formula |
C8H9Cl3Si |
| Canonical SMILES |
C1=CC=C(C=C1)CC[Si](Cl)(Cl)Cl |
| InChI |
InChI=1S/C8H9Cl3Si/c9-12(10,11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChI Key |
FMYXZXAKZWIOHO-UHFFFAOYSA-N |
| Boiling Point |
93-96/3 |
| Flash Point |
91°C |
| Purity |
97% |
| Density |
1.240 g/mL |
| Appearance |
Pale yellow liquid |
| Application |
Phenethyltrichlorosilane (PTS) is a valuable reagent that is utilized in the preparation of fluorinated polyhedral oligomeric silsesquioxanes. This silane-based capping agent is crucial in the formation of a self-assembled monolayer (SAM) on various surfaces, allowing for surface treatment and modification for enhanced detection of surface atoms. |
| Chemical Formula |
C8H9Cl3Si |
| Complexity |
127 |
| EC Number |
213-371-0 |
| Exact Mass |
237.95391 |
| Heavy Atom Count |
12 |
| Monoisotopic Mass |
237.95391 |
| Refractive Index |
1.5185 |
| Topological Polar Surface Area |
0 Ų |
