| Catalog Number |
ACM49539880 |
| CAS Number |
49539-88-0 |
| Structure |
 |
| Synonyms |
(2-Phenylethyl)trimethoxysilane |
| IUPAC Name |
Trimethoxy(2-phenylethyl)silane |
| Molecular Weight |
226.34 |
| Molecular Formula |
C11H18O3Si |
| Canonical SMILES |
CO[Si](CCC1=CC=CC=C1)(OC)OC |
| InChI |
InChI=1S/C11H18O3Si/c1-12-15(13-2,14-3)10-9-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChI Key |
UBMUZYGBAGFCDF-UHFFFAOYSA-N |
| Boiling Point |
95-96 °C/2 mmHg (lit.) |
| Melting Point |
<0 °C |
| Flash Point |
228 °F |
| Purity |
95%+ |
| Density |
1.033 g/mL at 25 °C (lit.) |
| Appearance |
Liquid |
| Application |
Phenethyltrimethoxysilane (TMPES) serves as a crucial component in the loading and releasing process of anti-cancer drugs, 9-Aminoacridine (9AA) and Camptothecin (CPT), from magnetic mesoporous silica nanoparticles. This phenyl functionalized trialkoxy silane acts as a siloxane based precursor, aiding in the efficient delivery of these drugs for targeted therapy purposes. |
| Complexity |
157 |
| EC Number |
256-363-2 |
| Exact Mass |
226.10252097 |
| Heavy Atom Count |
15 |
| Monoisotopic Mass |
226.10252097 |
| Packaging |
10 g; 100 g |
| Topological Polar Surface Area |
27.7 Ų |
